C11H16N2O4S — CID 81433885
4-amino-N-(2-hydroxy-5-methylsulfonylphenyl)butanamide (PubChem CID 81433885) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is 4-amino-N-(2-hydroxy-5-methylsulfonylphenyl)butanamide.
| Compound Name | 4-amino-N-(2-hydroxy-5-methylsulfonylphenyl)butanamide |
|---|---|
| PubChem CID | 81433885 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 4-amino-N-(2-hydroxy-5-methylsulfonylphenyl)butanamide |
| SMILES | CS(=O)(=O)c1ccc(O)c(NC(=O)CCCN)c1 |
| InChI | InChI=1S/C11H16N2O4S/c1-18(16,17)8-4-5-10(14)9(7-8)13-11(15)3-2-6-12/h4-5,7,14H,2-3,6,12H2,1H3,(H,13,15) |
| InChIKey | IRJVAONOIIWLAS-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|