C21H28N2O6S2 — CID 55464644
3-[(4-tert-butylphenyl)sulfonylamino]-N-(5-ethylsulfonyl-2-hydroxyphenyl)propanamide (PubChem CID 55464644) has the molecular formula C21H28N2O6S2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 3-[(4-tert-butylphenyl)sulfonylamino]-N-(5-ethylsulfonyl-2-hydroxyphenyl)propanamide.
| Compound Name | 3-[(4-tert-butylphenyl)sulfonylamino]-N-(5-ethylsulfonyl-2-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 55464644 |
| Molecular Formula | C21H28N2O6S2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 3-[(4-tert-butylphenyl)sulfonylamino]-N-(5-ethylsulfonyl-2-hydroxyphenyl)propanamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)CCNS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C21H28N2O6S2/c1-5-30(26,27)17-10-11-19(24)18(14-17)23-20(25)12-13-22-31(28,29)16-8-6-15(7-9-16)21(2,3)4/h6-11,14,22,24H,5,12-13H2,1-4H3,(H,23,25) |
| InChIKey | IZRNWUCUASUISW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|