C22H25N3O3S — CID 29330631
3-[(4-tert-butylphenyl)sulfonylamino]-N-quinolin-3-ylpropanamide (PubChem CID 29330631) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is 3-[(4-tert-butylphenyl)sulfonylamino]-N-quinolin-3-ylpropanamide.
| Compound Name | 3-[(4-tert-butylphenyl)sulfonylamino]-N-quinolin-3-ylpropanamide |
|---|---|
| PubChem CID | 29330631 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 3-[(4-tert-butylphenyl)sulfonylamino]-N-quinolin-3-ylpropanamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)NCCC(=O)Nc2cnc3ccccc3c2)cc1 |
| InChI | InChI=1S/C22H25N3O3S/c1-22(2,3)17-8-10-19(11-9-17)29(27,28)24-13-12-21(26)25-18-14-16-6-4-5-7-20(16)23-15-18/h4-11,14-15,24H,12-13H2,1-3H3,(H,25,26) |
| InChIKey | UJESNTZOBJRZQE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |