C18H17N3O3S — CID 52553671
3-(benzenesulfonamido)-N-quinolin-3-ylpropanamide (PubChem CID 52553671) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-N-quinolin-3-ylpropanamide.
| Compound Name | 3-(benzenesulfonamido)-N-quinolin-3-ylpropanamide |
|---|---|
| PubChem CID | 52553671 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 3-(benzenesulfonamido)-N-quinolin-3-ylpropanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccccc1)Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C18H17N3O3S/c22-18(10-11-20-25(23,24)16-7-2-1-3-8-16)21-15-12-14-6-4-5-9-17(14)19-13-15/h1-9,12-13,20H,10-11H2,(H,21,22) |
| InChIKey | VJUBLEWUAZIXRW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |