C20H22N2O4S2 — CID 55383684
5-(1,3-benzothiazol-2-yl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)pentanamide (PubChem CID 55383684) has the molecular formula C20H22N2O4S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)pentanamide.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)pentanamide |
|---|---|
| PubChem CID | 55383684 |
| Molecular Formula | C20H22N2O4S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)pentanamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)CCCCc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C20H22N2O4S2/c1-2-28(25,26)14-11-12-17(23)16(13-14)21-19(24)9-5-6-10-20-22-15-7-3-4-8-18(15)27-20/h3-4,7-8,11-13,23H,2,5-6,9-10H2,1H3,(H,21,24) |
| InChIKey | ZEXBLGPFLQDBQR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|