C20H21N3O6S — CID 19273318
N-(5-ethylsulfonyl-2-hydroxyphenyl)-1-[(4-methoxyphenoxy)methyl]pyrazole-3-carboxamide (PubChem CID 19273318) has the molecular formula C20H21N3O6S and a molecular weight of 431.47 g/mol. Its IUPAC name is N-(5-ethylsulfonyl-2-hydroxyphenyl)-1-[(4-methoxyphenoxy)methyl]pyrazole-3-carboxamide.
| Compound Name | N-(5-ethylsulfonyl-2-hydroxyphenyl)-1-[(4-methoxyphenoxy)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19273318 |
| Molecular Formula | C20H21N3O6S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | N-(5-ethylsulfonyl-2-hydroxyphenyl)-1-[(4-methoxyphenoxy)methyl]pyrazole-3-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)c2ccn(COc3ccc(OC)cc3)n2)c1 |
| InChI | InChI=1S/C20H21N3O6S/c1-3-30(26,27)16-8-9-19(24)18(12-16)21-20(25)17-10-11-23(22-17)13-29-15-6-4-14(28-2)5-7-15/h4-12,24H,3,13H2,1-2H3,(H,21,25) |
| InChIKey | NMJCAFMTZHDEOK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|