C19H17Cl2N3O5S — CID 19270106
1-[(2,6-dichlorophenoxy)methyl]-N-(5-ethylsulfonyl-2-hydroxyphenyl)pyrazole-3-carboxamide (PubChem CID 19270106) has the molecular formula C19H17Cl2N3O5S and a molecular weight of 470.33 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenoxy)methyl]-N-(5-ethylsulfonyl-2-hydroxyphenyl)pyrazole-3-carboxamide.
| Compound Name | 1-[(2,6-dichlorophenoxy)methyl]-N-(5-ethylsulfonyl-2-hydroxyphenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19270106 |
| Molecular Formula | C19H17Cl2N3O5S |
| Molecular Weight | 470.33 g/mol |
| Exact Mass | 469.03 |
| IUPAC Name | 1-[(2,6-dichlorophenoxy)methyl]-N-(5-ethylsulfonyl-2-hydroxyphenyl)pyrazole-3-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)c2ccn(COc3c(Cl)cccc3Cl)n2)c1 |
| InChI | InChI=1S/C19H17Cl2N3O5S/c1-2-30(27,28)12-6-7-17(25)16(10-12)22-19(26)15-8-9-24(23-15)11-29-18-13(20)4-3-5-14(18)21/h3-10,25H,2,11H2,1H3,(H,22,26) |
| InChIKey | LBTWUHZQBUUPJT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.33 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|