C17H12Cl2N4O5 — CID 19270109
1-[(2,6-dichlorophenoxy)methyl]-N-(2-hydroxy-4-nitrophenyl)pyrazole-3-carboxamide (PubChem CID 19270109) has the molecular formula C17H12Cl2N4O5 and a molecular weight of 423.21 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenoxy)methyl]-N-(2-hydroxy-4-nitrophenyl)pyrazole-3-carboxamide.
| Compound Name | 1-[(2,6-dichlorophenoxy)methyl]-N-(2-hydroxy-4-nitrophenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19270109 |
| Molecular Formula | C17H12Cl2N4O5 |
| Molecular Weight | 423.21 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | 1-[(2,6-dichlorophenoxy)methyl]-N-(2-hydroxy-4-nitrophenyl)pyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1O)c1ccn(COc2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C17H12Cl2N4O5/c18-11-2-1-3-12(19)16(11)28-9-22-7-6-14(21-22)17(25)20-13-5-4-10(23(26)27)8-15(13)24/h1-8,24H,9H2,(H,20,25) |
| InChIKey | XTVAHIATPIZPAH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.21 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|