C18H14N2O12S3 — CID 136638488
2-[(1-hydroxy-6-methyl-3,5-disulfonaphthalen-2-yl)diazenyl]-4-sulfobenzoic acid (PubChem CID 136638488) has the molecular formula C18H14N2O12S3 and a molecular weight of 546.51 g/mol. Its IUPAC name is 2-[(1-hydroxy-6-methyl-3,5-disulfonaphthalen-2-yl)diazenyl]-4-sulfobenzoic acid.
| Compound Name | 2-[(1-hydroxy-6-methyl-3,5-disulfonaphthalen-2-yl)diazenyl]-4-sulfobenzoic acid |
|---|---|
| PubChem CID | 136638488 |
| Molecular Formula | C18H14N2O12S3 |
| Molecular Weight | 546.51 g/mol |
| Exact Mass | 545.97 |
| IUPAC Name | 2-[(1-hydroxy-6-methyl-3,5-disulfonaphthalen-2-yl)diazenyl]-4-sulfobenzoic acid |
| SMILES | Cc1ccc2c(O)c(/N=N/c3cc(S(=O)(=O)O)ccc3C(=O)O)c(S(=O)(=O)O)cc2c1S(=O)(=O)O |
| InChI | InChI=1S/C18H14N2O12S3/c1-8-2-4-10-12(17(8)35(30,31)32)7-14(34(27,28)29)15(16(10)21)20-19-13-6-9(33(24,25)26)3-5-11(13)18(22)23/h2-7,21H,1H3,(H,22,23)(H,24,25,26)(H,27,28,29)(H,30,31,32)/b20-19+ |
| InChIKey | DQYZTCCTHDCQLP-FMQUCBEESA-N |
| XLogP | 2.71 |
| TPSA | 245.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|