C24H20N6O13S4 — CID 136599978
3-[(5-acetamido-2-sulfophenyl)diazenyl]-7-amino-4-hydroxy-8-[(4-sulfino-2-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 136599978) has the molecular formula C24H20N6O13S4 and a molecular weight of 728.72 g/mol. Its IUPAC name is 3-[(5-acetamido-2-sulfophenyl)diazenyl]-7-amino-4-hydroxy-8-[(4-sulfino-2-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 3-[(5-acetamido-2-sulfophenyl)diazenyl]-7-amino-4-hydroxy-8-[(4-sulfino-2-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136599978 |
| Molecular Formula | C24H20N6O13S4 |
| Molecular Weight | 728.72 g/mol |
| Exact Mass | 728.00 |
| IUPAC Name | 3-[(5-acetamido-2-sulfophenyl)diazenyl]-7-amino-4-hydroxy-8-[(4-sulfino-2-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)O)c(/N=N/c2c(S(=O)(=O)O)cc3c(/N=N/c4ccc(S(=O)O)cc4S(=O)(=O)O)c(N)ccc3c2O)c1 |
| InChI | InChI=1S/C24H20N6O13S4/c1-11(31)26-12-2-7-19(45(35,36)37)18(8-12)28-30-23-21(47(41,42)43)10-15-14(24(23)32)4-5-16(25)22(15)29-27-17-6-3-13(44(33)34)9-20(17)46(38,39)40/h2-10,32H,25H2,1H3,(H,26,31)(H,33,34)(H,35,36,37)(H,38,39,40)(H,41,42,43)/b29-27+,30-28+ |
| InChIKey | MNMPYOIJHWWNPF-QAVVBOBSSA-N |
| XLogP | 4.24 |
| TPSA | 325.20 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.72 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|