C27H26N6O13S3 — CID 142839088
3-[(4-acetamido-2-sulfophenyl)diazenyl]-6-[(4-amino-2,5-dimethoxyphenyl)diazenyl]-5-hydroxy-4-methylnaphthalene-2,7-disulfonic acid (PubChem CID 142839088) has the molecular formula C27H26N6O13S3 and a molecular weight of 738.73 g/mol. Its IUPAC name is 3-[(4-acetamido-2-sulfophenyl)diazenyl]-6-[(4-amino-2,5-dimethoxyphenyl)diazenyl]-5-hydroxy-4-methylnaphthalene-2,7-disulfonic acid.
| Compound Name | 3-[(4-acetamido-2-sulfophenyl)diazenyl]-6-[(4-amino-2,5-dimethoxyphenyl)diazenyl]-5-hydroxy-4-methylnaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 142839088 |
| Molecular Formula | C27H26N6O13S3 |
| Molecular Weight | 738.73 g/mol |
| Exact Mass | 738.07 |
| IUPAC Name | 3-[(4-acetamido-2-sulfophenyl)diazenyl]-6-[(4-amino-2,5-dimethoxyphenyl)diazenyl]-5-hydroxy-4-methylnaphthalene-2,7-disulfonic acid |
| SMILES | COc1cc(/N=N/c2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)c(/N=N/c4ccc(NC(C)=O)cc4S(=O)(=O)O)c(C)c3c2O)c(OC)cc1N |
| InChI | InChI=1S/C27H26N6O13S3/c1-12-24-14(8-23(49(42,43)44)26(27(24)35)33-31-18-11-19(45-3)16(28)10-20(18)46-4)7-22(48(39,40)41)25(12)32-30-17-6-5-15(29-13(2)34)9-21(17)47(36,37)38/h5-11,35H,28H2,1-4H3,(H,29,34)(H,36,37,38)(H,39,40,41)(H,42,43,44)/b32-30+,33-31+ |
| InChIKey | HSEIIUQBIOVSNY-RRPBDJRISA-N |
| XLogP | 4.98 |
| TPSA | 306.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.73 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|