C23H24N6O15S4 — CID 142841796
3-amino-6-[(4-amino-2-sulfophenyl)diazenyl]-4,5-dihydroxynaphthalene-2,7-disulfonic acid;2-amino-5-(methoxyamino)benzenesulfonic acid (PubChem CID 142841796) has the molecular formula C23H24N6O15S4 and a molecular weight of 752.74 g/mol. Its IUPAC name is 3-amino-6-[(4-amino-2-sulfophenyl)diazenyl]-4,5-dihydroxynaphthalene-2,7-disulfonic acid;2-amino-5-(methoxyamino)benzenesulfonic acid.
| Compound Name | 3-amino-6-[(4-amino-2-sulfophenyl)diazenyl]-4,5-dihydroxynaphthalene-2,7-disulfonic acid;2-amino-5-(methoxyamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 142841796 |
| Molecular Formula | C23H24N6O15S4 |
| Molecular Weight | 752.74 g/mol |
| Exact Mass | 752.02 |
| IUPAC Name | 3-amino-6-[(4-amino-2-sulfophenyl)diazenyl]-4,5-dihydroxynaphthalene-2,7-disulfonic acid;2-amino-5-(methoxyamino)benzenesulfonic acid |
| SMILES | CONc1ccc(N)c(S(=O)(=O)O)c1.Nc1ccc(/N=N/c2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)c(N)c(O)c3c2O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C16H14N4O11S3.C7H10N2O4S/c17-7-1-2-8(9(5-7)32(23,24)25)19-20-14-11(34(29,30)31)4-6-3-10(33(26,27)28)13(18)15(21)12(6)16(14)22;1-13-9-5-2-3-6(8)7(4-5)14(10,11)12/h1-5,21-22H,17-18H2,(H,23,24,25)(H,26,27,28)(H,29,30,31);2-4,9H,8H2,1H3,(H,10,11,12)/b20-19+; |
| InChIKey | QNXXBBJETPZECC-RZLHGTIFSA-N |
| XLogP | 2.06 |
| TPSA | 381.98 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.74 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|