C31H24N8O17S3 — CID 135812911
5-[[7-[[4-[(4-amino-2-sulfophenyl)diazenyl]-2,5-dimethoxyphenyl]diazenyl]-1,8-dihydroxy-3,6-disulfonaphthalen-2-yl]diazenyl]-2-nitrobenzoic acid (PubChem CID 135812911) has the molecular formula C31H24N8O17S3 and a molecular weight of 876.77 g/mol. Its IUPAC name is 5-[[7-[[4-[(4-amino-2-sulfophenyl)diazenyl]-2,5-dimethoxyphenyl]diazenyl]-1,8-dihydroxy-3,6-disulfonaphthalen-2-yl]diazenyl]-2-nitrobenzoic acid.
| Compound Name | 5-[[7-[[4-[(4-amino-2-sulfophenyl)diazenyl]-2,5-dimethoxyphenyl]diazenyl]-1,8-dihydroxy-3,6-disulfonaphthalen-2-yl]diazenyl]-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 135812911 |
| Molecular Formula | C31H24N8O17S3 |
| Molecular Weight | 876.77 g/mol |
| Exact Mass | 876.04 |
| IUPAC Name | 5-[[7-[[4-[(4-amino-2-sulfophenyl)diazenyl]-2,5-dimethoxyphenyl]diazenyl]-1,8-dihydroxy-3,6-disulfonaphthalen-2-yl]diazenyl]-2-nitrobenzoic acid |
| SMILES | COc1cc(/N=N/c2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)c(/N=N/c4ccc([N+](=O)[O-])c(C(=O)O)c4)c(O)c3c2O)c(OC)cc1/N=N/c1ccc(N)cc1S(=O)(=O)O |
| InChI | InChI=1S/C31H24N8O17S3/c1-55-21-12-19(22(56-2)11-18(21)35-34-17-5-3-14(32)9-23(17)57(46,47)48)36-38-28-25(59(52,53)54)8-13-7-24(58(49,50)51)27(29(40)26(13)30(28)41)37-33-15-4-6-20(39(44)45)16(10-15)31(42)43/h3-12,40-41H,32H2,1-2H3,(H,42,43)(H,46,47,48)(H,49,50,51)(H,52,53,54)/b35-34+,37-33+,38-36+ |
| InChIKey | QZKXXZOQYZLMAX-FQUYQVTPSA-N |
| XLogP | 6.44 |
| TPSA | 402.65 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 59 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.77 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|