C24H19N6O13S4- — CID 136599977
4-[[6-[(5-acetamido-2-sulfophenyl)diazenyl]-2-amino-5-hydroxy-7-sulfonaphthalen-1-yl]diazenyl]-3-sulfobenzenesulfinate (PubChem CID 136599977) has the molecular formula C24H19N6O13S4- and a molecular weight of 727.71 g/mol. Its IUPAC name is 4-[[6-[(5-acetamido-2-sulfophenyl)diazenyl]-2-amino-5-hydroxy-7-sulfonaphthalen-1-yl]diazenyl]-3-sulfobenzenesulfinate.
| Compound Name | 4-[[6-[(5-acetamido-2-sulfophenyl)diazenyl]-2-amino-5-hydroxy-7-sulfonaphthalen-1-yl]diazenyl]-3-sulfobenzenesulfinate |
|---|---|
| PubChem CID | 136599977 |
| Molecular Formula | C24H19N6O13S4- |
| Molecular Weight | 727.71 g/mol |
| Exact Mass | 726.99 |
| IUPAC Name | 4-[[6-[(5-acetamido-2-sulfophenyl)diazenyl]-2-amino-5-hydroxy-7-sulfonaphthalen-1-yl]diazenyl]-3-sulfobenzenesulfinate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)O)c(/N=N/c2c(S(=O)(=O)O)cc3c(/N=N/c4ccc(S(=O)[O-])cc4S(=O)(=O)O)c(N)ccc3c2O)c1 |
| InChI | InChI=1S/C24H20N6O13S4/c1-11(31)26-12-2-7-19(45(35,36)37)18(8-12)28-30-23-21(47(41,42)43)10-15-14(24(23)32)4-5-16(25)22(15)29-27-17-6-3-13(44(33)34)9-20(17)46(38,39)40/h2-10,32H,25H2,1H3,(H,26,31)(H,33,34)(H,35,36,37)(H,38,39,40)(H,41,42,43)/p-1/b29-27+,30-28+ |
| InChIKey | MNMPYOIJHWWNPF-QAVVBOBSSA-M |
| XLogP | 3.89 |
| TPSA | 328.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.71 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|