C26H21N5O11S4 — CID 155608056
4-amino-3-[(4-ethenylsulfonylphenyl)diazenyl]-5-hydroxy-6-[[4-(1-sulfinoethenyl)-2-sulfophenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 155608056) has the molecular formula C26H21N5O11S4 and a molecular weight of 707.75 g/mol. Its IUPAC name is 4-amino-3-[(4-ethenylsulfonylphenyl)diazenyl]-5-hydroxy-6-[[4-(1-sulfinoethenyl)-2-sulfophenyl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 4-amino-3-[(4-ethenylsulfonylphenyl)diazenyl]-5-hydroxy-6-[[4-(1-sulfinoethenyl)-2-sulfophenyl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 155608056 |
| Molecular Formula | C26H21N5O11S4 |
| Molecular Weight | 707.75 g/mol |
| Exact Mass | 707.01 |
| IUPAC Name | 4-amino-3-[(4-ethenylsulfonylphenyl)diazenyl]-5-hydroxy-6-[[4-(1-sulfinoethenyl)-2-sulfophenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | C=CS(=O)(=O)c1ccc(/N=N/c2c(S(=O)(=O)O)cc3ccc(/N=N/c4ccc(C(=C)S(=O)O)cc4S(=O)(=O)O)c(O)c3c2N)cc1 |
| InChI | InChI=1S/C26H21N5O11S4/c1-3-44(35,36)18-8-6-17(7-9-18)28-31-25-22(46(40,41)42)13-16-5-11-20(26(32)23(16)24(25)27)30-29-19-10-4-15(14(2)43(33)34)12-21(19)45(37,38)39/h3-13,32H,1-2,27H2,(H,33,34)(H,37,38,39)(H,40,41,42)/b30-29+,31-28+ |
| InChIKey | NKRUPHICNCJPMB-JZXBUVORSA-N |
| XLogP | 5.56 |
| TPSA | 275.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.75 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|