C27H23N5O3S — CID 88888503
3-[2-[4-[(4-amino-6-methylnaphthalen-1-yl)diazenyl]naphthalen-1-yl]hydrazinyl]benzenesulfonic acid (PubChem CID 88888503) has the molecular formula C27H23N5O3S and a molecular weight of 497.58 g/mol. Its IUPAC name is 3-[2-[4-[(4-amino-6-methylnaphthalen-1-yl)diazenyl]naphthalen-1-yl]hydrazinyl]benzenesulfonic acid.
| Compound Name | 3-[2-[4-[(4-amino-6-methylnaphthalen-1-yl)diazenyl]naphthalen-1-yl]hydrazinyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 88888503 |
| Molecular Formula | C27H23N5O3S |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | 3-[2-[4-[(4-amino-6-methylnaphthalen-1-yl)diazenyl]naphthalen-1-yl]hydrazinyl]benzenesulfonic acid |
| SMILES | Cc1ccc2c(/N=N/c3ccc(NNc4cccc(S(=O)(=O)O)c4)c4ccccc34)ccc(N)c2c1 |
| InChI | InChI=1S/C27H23N5O3S/c1-17-9-10-22-23(15-17)24(28)11-12-25(22)31-32-27-14-13-26(20-7-2-3-8-21(20)27)30-29-18-5-4-6-19(16-18)36(33,34)35/h2-16,29-30H,28H2,1H3,(H,33,34,35)/b32-31+ |
| InChIKey | WBZLUEHOQUGLMQ-QNEJGDQOSA-N |
| XLogP | 6.98 |
| TPSA | 129.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|