C16H12N3O5PS — CID 139649873
[3-[(4-amino-6-sulfonaphthalen-1-yl)diazenyl]phenyl]-oxido-oxophosphanium (PubChem CID 139649873) has the molecular formula C16H12N3O5PS and a molecular weight of 389.33 g/mol. Its IUPAC name is [3-[(4-amino-6-sulfonaphthalen-1-yl)diazenyl]phenyl]-oxido-oxophosphanium.
| Compound Name | [3-[(4-amino-6-sulfonaphthalen-1-yl)diazenyl]phenyl]-oxido-oxophosphanium |
|---|---|
| PubChem CID | 139649873 |
| Molecular Formula | C16H12N3O5PS |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | [3-[(4-amino-6-sulfonaphthalen-1-yl)diazenyl]phenyl]-oxido-oxophosphanium |
| SMILES | Nc1ccc(/N=N/c2cccc([P+](=O)[O-])c2)c2ccc(S(=O)(=O)O)cc12 |
| InChI | InChI=1S/C16H12N3O5PS/c17-15-6-7-16(13-5-4-12(9-14(13)15)26(22,23)24)19-18-10-2-1-3-11(8-10)25(20)21/h1-9H,17H2,(H,22,23,24)/b19-18+ |
| InChIKey | SUPSFZHWTKLIJX-VHEBQXMUSA-N |
| XLogP | 2.81 |
| TPSA | 145.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|