C23H21N3O10S3 — CID 137492471
7-[(4-amino-6-sulfonaphthalen-1-yl)diazenyl]-4-(3-sulfopropoxy)naphthalene-2-sulfonic acid (PubChem CID 137492471) has the molecular formula C23H21N3O10S3 and a molecular weight of 595.63 g/mol. Its IUPAC name is 7-[(4-amino-6-sulfonaphthalen-1-yl)diazenyl]-4-(3-sulfopropoxy)naphthalene-2-sulfonic acid.
| Compound Name | 7-[(4-amino-6-sulfonaphthalen-1-yl)diazenyl]-4-(3-sulfopropoxy)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 137492471 |
| Molecular Formula | C23H21N3O10S3 |
| Molecular Weight | 595.63 g/mol |
| Exact Mass | 595.04 |
| IUPAC Name | 7-[(4-amino-6-sulfonaphthalen-1-yl)diazenyl]-4-(3-sulfopropoxy)naphthalene-2-sulfonic acid |
| SMILES | Nc1ccc(/N=N/c2ccc3c(OCCCS(=O)(=O)O)cc(S(=O)(=O)O)cc3c2)c2ccc(S(=O)(=O)O)cc12 |
| InChI | InChI=1S/C23H21N3O10S3/c24-21-6-7-22(19-5-3-16(12-20(19)21)38(30,31)32)26-25-15-2-4-18-14(10-15)11-17(39(33,34)35)13-23(18)36-8-1-9-37(27,28)29/h2-7,10-13H,1,8-9,24H2,(H,27,28,29)(H,30,31,32)(H,33,34,35)/b26-25+ |
| InChIKey | KETDWWPLNHJDJT-OCEACIFDSA-N |
| XLogP | 4.14 |
| TPSA | 223.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.63 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|