C46H36N6O10S4 — CID 4047079
8-anilino-5-[[5-[3-[(4-anilino-5-sulfonaphthalen-1-yl)diazenyl]-4-methoxyphenyl]sulfonylsulfanyl-2-methoxyphenyl]diazenyl]naphthalene-1-sulfonic acid (PubChem CID 4047079) has the molecular formula C46H36N6O10S4 and a molecular weight of 961.09 g/mol. Its IUPAC name is 8-anilino-5-[[5-[3-[(4-anilino-5-sulfonaphthalen-1-yl)diazenyl]-4-methoxyphenyl]sulfonylsulfanyl-2-methoxyphenyl]diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 8-anilino-5-[[5-[3-[(4-anilino-5-sulfonaphthalen-1-yl)diazenyl]-4-methoxyphenyl]sulfonylsulfanyl-2-methoxyphenyl]diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 4047079 |
| Molecular Formula | C46H36N6O10S4 |
| Molecular Weight | 961.09 g/mol |
| Exact Mass | 960.14 |
| IUPAC Name | 8-anilino-5-[[5-[3-[(4-anilino-5-sulfonaphthalen-1-yl)diazenyl]-4-methoxyphenyl]sulfonylsulfanyl-2-methoxyphenyl]diazenyl]naphthalene-1-sulfonic acid |
| SMILES | COc1ccc(SS(=O)(=O)c2ccc(OC)c(/N=N/c3ccc(Nc4ccccc4)c4c(S(=O)(=O)O)cccc34)c2)cc1/N=N/c1ccc(Nc2ccccc2)c2c(S(=O)(=O)O)cccc12 |
| InChI | InChI=1S/C46H36N6O10S4/c1-61-41-25-19-31(27-39(41)51-49-35-21-23-37(47-29-11-5-3-6-12-29)45-33(35)15-9-17-43(45)64(53,54)55)63-66(59,60)32-20-26-42(62-2)40(28-32)52-50-36-22-24-38(48-30-13-7-4-8-14-30)46-34(36)16-10-18-44(46)65(56,57)58/h3-28,47-48H,1-2H3,(H,53,54,55)(H,56,57,58)/b51-49+,52-50+ |
| InChIKey | WHUXUKCVTTVIGK-BILXIUEVSA-N |
| XLogP | 12.30 |
| TPSA | 234.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 961.09 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|