C29H22N4O11S2 — CID 170265359
5-[[4-[(Z)-2-[4-[(3-acetyl-4-hydroxyphenyl)diazenyl]-2-sulfophenyl]ethenyl]-3-sulfophenyl]diazenyl]-2-hydroxybenzoic acid (PubChem CID 170265359) has the molecular formula C29H22N4O11S2 and a molecular weight of 666.65 g/mol. Its IUPAC name is 5-[[4-[(Z)-2-[4-[(3-acetyl-4-hydroxyphenyl)diazenyl]-2-sulfophenyl]ethenyl]-3-sulfophenyl]diazenyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[[4-[(Z)-2-[4-[(3-acetyl-4-hydroxyphenyl)diazenyl]-2-sulfophenyl]ethenyl]-3-sulfophenyl]diazenyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 170265359 |
| Molecular Formula | C29H22N4O11S2 |
| Molecular Weight | 666.65 g/mol |
| Exact Mass | 666.07 |
| IUPAC Name | 5-[[4-[(Z)-2-[4-[(3-acetyl-4-hydroxyphenyl)diazenyl]-2-sulfophenyl]ethenyl]-3-sulfophenyl]diazenyl]-2-hydroxybenzoic acid |
| SMILES | CC(=O)c1cc(/N=N/c2ccc(/C=C\c3ccc(/N=N/c4ccc(O)c(C(=O)O)c4)cc3S(=O)(=O)O)c(S(=O)(=O)O)c2)ccc1O |
| InChI | InChI=1S/C29H22N4O11S2/c1-16(34)23-12-19(8-10-25(23)35)30-32-21-6-4-17(27(14-21)45(39,40)41)2-3-18-5-7-22(15-28(18)46(42,43)44)33-31-20-9-11-26(36)24(13-20)29(37)38/h2-15,35-36H,1H3,(H,37,38)(H,39,40,41)(H,42,43,44)/b3-2-,32-30+,33-31+ |
| InChIKey | RTILDFHHHSKWDZ-GAHOEBGDSA-N |
| XLogP | 6.49 |
| TPSA | 253.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.65 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|