C40H28N8O9S2 — CID 173472186
4-[[4-[[4-[(Z)-2-[4-[[4-[(4-carboxyphenyl)diazenyl]phenyl]diazenyl]-2-sulfophenyl]ethenyl]-3-hydroxysulfanyloxyphenyl]diazenyl]phenyl]diazenyl]benzoic acid (PubChem CID 173472186) has the molecular formula C40H28N8O9S2 and a molecular weight of 828.85 g/mol. Its IUPAC name is 4-[[4-[[4-[(Z)-2-[4-[[4-[(4-carboxyphenyl)diazenyl]phenyl]diazenyl]-2-sulfophenyl]ethenyl]-3-hydroxysulfanyloxyphenyl]diazenyl]phenyl]diazenyl]benzoic acid.
| Compound Name | 4-[[4-[[4-[(Z)-2-[4-[[4-[(4-carboxyphenyl)diazenyl]phenyl]diazenyl]-2-sulfophenyl]ethenyl]-3-hydroxysulfanyloxyphenyl]diazenyl]phenyl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 173472186 |
| Molecular Formula | C40H28N8O9S2 |
| Molecular Weight | 828.85 g/mol |
| Exact Mass | 828.14 |
| IUPAC Name | 4-[[4-[[4-[(Z)-2-[4-[[4-[(4-carboxyphenyl)diazenyl]phenyl]diazenyl]-2-sulfophenyl]ethenyl]-3-hydroxysulfanyloxyphenyl]diazenyl]phenyl]diazenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(/N=N/c2ccc(/N=N/c3ccc(/C=C\c4ccc(/N=N/c5ccc(/N=N/c6ccc(C(=O)O)cc6)cc5)cc4S(=O)(=O)O)c(OSO)c3)cc2)cc1 |
| InChI | InChI=1S/C40H28N8O9S2/c49-39(50)27-5-9-29(10-6-27)41-43-31-15-19-33(20-16-31)45-47-35-13-3-25(37(23-35)57-58-53)1-2-26-4-14-36(24-38(26)59(54,55)56)48-46-34-21-17-32(18-22-34)44-42-30-11-7-28(8-12-30)40(51)52/h1-24,53H,(H,49,50)(H,51,52)(H,54,55,56)/b2-1-,43-41+,44-42+,47-45+,48-46+ |
| InChIKey | OEAKLYKMROXVPA-RPWUJFCPSA-N |
| XLogP | 12.66 |
| TPSA | 257.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.85 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|