C14H12N2O8S2 — CID 142098792
3-amino-6-[2-(4-nitrophenyl)ethenyl]benzene-1,2-disulfonic acid (PubChem CID 142098792) has the molecular formula C14H12N2O8S2 and a molecular weight of 400.39 g/mol. Its IUPAC name is 3-amino-6-[2-(4-nitrophenyl)ethenyl]benzene-1,2-disulfonic acid.
| Compound Name | 3-amino-6-[2-(4-nitrophenyl)ethenyl]benzene-1,2-disulfonic acid |
|---|---|
| PubChem CID | 142098792 |
| Molecular Formula | C14H12N2O8S2 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | 3-amino-6-[2-(4-nitrophenyl)ethenyl]benzene-1,2-disulfonic acid |
| SMILES | Nc1ccc(C=Cc2ccc([N+](=O)[O-])cc2)c(S(=O)(=O)O)c1S(=O)(=O)O |
| InChI | InChI=1S/C14H12N2O8S2/c15-12-8-5-10(13(25(19,20)21)14(12)26(22,23)24)4-1-9-2-6-11(7-3-9)16(17)18/h1-8H,15H2,(H,19,20,21)(H,22,23,24) |
| InChIKey | DRMLVYSKNWSNOC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 177.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|