C11H10N2O8S2 — CID 143971979
3-(methylamino)-7-nitronaphthalene-1,5-disulfonic acid (PubChem CID 143971979) has the molecular formula C11H10N2O8S2 and a molecular weight of 362.34 g/mol. Its IUPAC name is 3-(methylamino)-7-nitronaphthalene-1,5-disulfonic acid.
| Compound Name | 3-(methylamino)-7-nitronaphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 143971979 |
| Molecular Formula | C11H10N2O8S2 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | 3-(methylamino)-7-nitronaphthalene-1,5-disulfonic acid |
| SMILES | CNc1cc(S(=O)(=O)O)c2cc([N+](=O)[O-])cc(S(=O)(=O)O)c2c1 |
| InChI | InChI=1S/C11H10N2O8S2/c1-12-6-2-8-9(10(3-6)22(16,17)18)4-7(13(14)15)5-11(8)23(19,20)21/h2-5,12H,1H3,(H,16,17,18)(H,19,20,21) |
| InChIKey | CORIOIZAMJFGQY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 163.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|