C23H22N2O3 — CID 102345178
[4-[(2,4-dimethylphenyl)diazenyl]-2-methylphenyl] 4-methoxybenzoate (PubChem CID 102345178) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is [4-[(2,4-dimethylphenyl)diazenyl]-2-methylphenyl] 4-methoxybenzoate.
| Compound Name | [4-[(2,4-dimethylphenyl)diazenyl]-2-methylphenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 102345178 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | [4-[(2,4-dimethylphenyl)diazenyl]-2-methylphenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(/N=N/c3ccc(C)cc3C)cc2C)cc1 |
| InChI | InChI=1S/C23H22N2O3/c1-15-5-11-21(16(2)13-15)25-24-19-8-12-22(17(3)14-19)28-23(26)18-6-9-20(27-4)10-7-18/h5-14H,1-4H3/b25-24+ |
| InChIKey | KCCSVYJWTREFQR-OCOZRVBESA-N |
| XLogP | 6.26 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|