C23H21ClN2O3 — CID 102525981
[2-chloro-4-[(2,4-dimethylphenyl)diazenyl]phenyl] 4-ethoxybenzoate (PubChem CID 102525981) has the molecular formula C23H21ClN2O3 and a molecular weight of 408.89 g/mol. Its IUPAC name is [2-chloro-4-[(2,4-dimethylphenyl)diazenyl]phenyl] 4-ethoxybenzoate.
| Compound Name | [2-chloro-4-[(2,4-dimethylphenyl)diazenyl]phenyl] 4-ethoxybenzoate |
|---|---|
| PubChem CID | 102525981 |
| Molecular Formula | C23H21ClN2O3 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | [2-chloro-4-[(2,4-dimethylphenyl)diazenyl]phenyl] 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccc(/N=N/c3ccc(C)cc3C)cc2Cl)cc1 |
| InChI | InChI=1S/C23H21ClN2O3/c1-4-28-19-9-6-17(7-10-19)23(27)29-22-12-8-18(14-20(22)24)25-26-21-11-5-15(2)13-16(21)3/h5-14H,4H2,1-3H3/b26-25+ |
| InChIKey | VSHVVRGTSBDRAS-OCEACIFDSA-N |
| XLogP | 6.99 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|