C42H50N2O8 — CID 102016300
[4-[[2,3-dibutoxy-4-(4-butoxybenzoyl)oxyphenyl]diazenyl]phenyl] 4-butoxybenzoate (PubChem CID 102016300) has the molecular formula C42H50N2O8 and a molecular weight of 710.87 g/mol. Its IUPAC name is [4-[[2,3-dibutoxy-4-(4-butoxybenzoyl)oxyphenyl]diazenyl]phenyl] 4-butoxybenzoate.
| Compound Name | [4-[[2,3-dibutoxy-4-(4-butoxybenzoyl)oxyphenyl]diazenyl]phenyl] 4-butoxybenzoate |
|---|---|
| PubChem CID | 102016300 |
| Molecular Formula | C42H50N2O8 |
| Molecular Weight | 710.87 g/mol |
| Exact Mass | 710.36 |
| IUPAC Name | [4-[[2,3-dibutoxy-4-(4-butoxybenzoyl)oxyphenyl]diazenyl]phenyl] 4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)Oc2ccc(/N=N/c3ccc(OC(=O)c4ccc(OCCCC)cc4)c(OCCCC)c3OCCCC)cc2)cc1 |
| InChI | InChI=1S/C42H50N2O8/c1-5-9-27-47-34-19-13-31(14-20-34)41(45)51-36-23-17-33(18-24-36)43-44-37-25-26-38(40(50-30-12-8-4)39(37)49-29-11-7-3)52-42(46)32-15-21-35(22-16-32)48-28-10-6-2/h13-26H,5-12,27-30H2,1-4H3/b44-43+ |
| InChIKey | JERHHPHMOOOKDZ-VGFSZAGXSA-N |
| XLogP | 11.26 |
| TPSA | 114.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.87 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|