C12H14N2O4 — CID 116819828
(3,5-dimethoxyphenyl) N-(cyanomethyl)-N-methylcarbamate (PubChem CID 116819828) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl) N-(cyanomethyl)-N-methylcarbamate.
| Compound Name | (3,5-dimethoxyphenyl) N-(cyanomethyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 116819828 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (3,5-dimethoxyphenyl) N-(cyanomethyl)-N-methylcarbamate |
| SMILES | COc1cc(OC)cc(OC(=O)N(C)CC#N)c1 |
| InChI | InChI=1S/C12H14N2O4/c1-14(5-4-13)12(15)18-11-7-9(16-2)6-10(8-11)17-3/h6-8H,5H2,1-3H3 |
| InChIKey | WYPBVIUJEPGUMN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|