About (3,5-dimethoxyphenyl) dimethylaminosulfanylformate
(3,5-dimethoxyphenyl) dimethylaminosulfanylformate (PubChem CID 21435210) has the molecular formula C11H15NO4S
and a molecular weight of 257.31 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl) dimethylaminosulfanylformate.
Molecular Properties
| Compound Name | (3,5-dimethoxyphenyl) dimethylaminosulfanylformate |
| PubChem CID | 21435210 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | (3,5-dimethoxyphenyl) dimethylaminosulfanylformate |
| SMILES | COc1cc(OC)cc(OC(=O)SN(C)C)c1 |
| InChI | InChI=1S/C11H15NO4S/c1-12(2)17-11(13)16-10-6-8(14-3)5-9(7-10)15-4/h5-7H,1-4H3 |
| InChIKey | ZQOGCCVYPJANHP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze (3,5-dimethoxyphenyl) dimethylaminosulfanylformate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dimethoxyphenyl) dimethylaminosulfanylformate?
The IUPAC name of (3,5-dimethoxyphenyl) dimethylaminosulfanylformate (CID 21435210) is (3,5-dimethoxyphenyl) dimethylaminosulfanylformate.
What is the SMILES notation for (3,5-dimethoxyphenyl) dimethylaminosulfanylformate?
The canonical SMILES for (3,5-dimethoxyphenyl) dimethylaminosulfanylformate is COc1cc(OC)cc(OC(=O)SN(C)C)c1.
What is the InChIKey of (3,5-dimethoxyphenyl) dimethylaminosulfanylformate?
The InChIKey is ZQOGCCVYPJANHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO4S/c1-12(2)17-11(13)16-10-6-8(14-3)5-9(7-10)15-4/h5-7H,1-4H3.
What are the key properties of (3,5-dimethoxyphenyl) dimethylaminosulfanylformate?
(3,5-dimethoxyphenyl) dimethylaminosulfanylformate has a molecular weight of 257.31 g/mol, XLogP of 2.41, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethoxyphenyl) dimethylaminosulfanylformate is sourced from PubChem (CID 21435210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).