C12H16BrNO3 — CID 80659809
N-(2-bromoethyl)-3,5-dimethoxy-N-methylbenzamide (PubChem CID 80659809) has the molecular formula C12H16BrNO3 and a molecular weight of 302.17 g/mol. Its IUPAC name is N-(2-bromoethyl)-3,5-dimethoxy-N-methylbenzamide.
| Compound Name | N-(2-bromoethyl)-3,5-dimethoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 80659809 |
| Molecular Formula | C12H16BrNO3 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | N-(2-bromoethyl)-3,5-dimethoxy-N-methylbenzamide |
| SMILES | COc1cc(OC)cc(C(=O)N(C)CCBr)c1 |
| InChI | InChI=1S/C12H16BrNO3/c1-14(5-4-13)12(15)9-6-10(16-2)8-11(7-9)17-3/h6-8H,4-5H2,1-3H3 |
| InChIKey | FAYSHXZJNJDPGP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|