C15H22N2O6 — CID 154905672
3-[2-(dimethylamino)ethyl-methylcarbamoyl]-5-methoxybenzoic acid;formic acid (PubChem CID 154905672) has the molecular formula C15H22N2O6 and a molecular weight of 326.35 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl-methylcarbamoyl]-5-methoxybenzoic acid;formic acid.
| Compound Name | 3-[2-(dimethylamino)ethyl-methylcarbamoyl]-5-methoxybenzoic acid;formic acid |
|---|---|
| PubChem CID | 154905672 |
| Molecular Formula | C15H22N2O6 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl-methylcarbamoyl]-5-methoxybenzoic acid;formic acid |
| SMILES | COc1cc(C(=O)O)cc(C(=O)N(C)CCN(C)C)c1.O=CO |
| InChI | InChI=1S/C14H20N2O4.CH2O2/c1-15(2)5-6-16(3)13(17)10-7-11(14(18)19)9-12(8-10)20-4;2-1-3/h7-9H,5-6H2,1-4H3,(H,18,19);1H,(H,2,3) |
| InChIKey | GOYKXBPXHIVBIW-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|