About 3-[[(2S)-1,4-dioxan-2-yl]methyl-methylcarbamoyl]-5-methoxybenzoic acid
3-[[(2S)-1,4-dioxan-2-yl]methyl-methylcarbamoyl]-5-methoxybenzoic acid (PubChem CID 125439013) has the molecular formula C15H19NO6
and a molecular weight of 309.32 g/mol. Its IUPAC name is 3-[[(2S)-1,4-dioxan-2-yl]methyl-methylcarbamoyl]-5-methoxybenzoic acid.
Molecular Properties
| Compound Name | 3-[[(2S)-1,4-dioxan-2-yl]methyl-methylcarbamoyl]-5-methoxybenzoic acid |
| PubChem CID | 125439013 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 3-[[(2S)-1,4-dioxan-2-yl]methyl-methylcarbamoyl]-5-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)cc(C(=O)N(C)C[C@H]2COCCO2)c1 |
| InChI | InChI=1S/C15H19NO6/c1-16(8-13-9-21-3-4-22-13)14(17)10-5-11(15(18)19)7-12(6-10)20-2/h5-7,13H,3-4,8-9H2,1-2H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | SZSKBIANQHRWSS-ZDUSSCGKSA-N |
| XLogP | 0.88 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[(2S)-1,4-dioxan-2-yl]methyl-methylcarbamoyl]-5-methoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(2S)-1,4-dioxan-2-yl]methyl-methylcarbamoyl]-5-methoxybenzoic acid?
The IUPAC name of 3-[[(2S)-1,4-dioxan-2-yl]methyl-methylcarbamoyl]-5-methoxybenzoic acid (CID 125439013) is 3-[[(2S)-1,4-dioxan-2-yl]methyl-methylcarbamoyl]-5-methoxybenzoic acid.
What is the SMILES notation for 3-[[(2S)-1,4-dioxan-2-yl]methyl-methylcarbamoyl]-5-methoxybenzoic acid?
The canonical SMILES for 3-[[(2S)-1,4-dioxan-2-yl]methyl-methylcarbamoyl]-5-methoxybenzoic acid is COc1cc(C(=O)O)cc(C(=O)N(C)C[C@H]2COCCO2)c1.
What is the InChIKey of 3-[[(2S)-1,4-dioxan-2-yl]methyl-methylcarbamoyl]-5-methoxybenzoic acid?
The InChIKey is SZSKBIANQHRWSS-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H19NO6/c1-16(8-13-9-21-3-4-22-13)14(17)10-5-11(15(18)19)7-12(6-10)20-2/h5-7,13H,3-4,8-9H2,1-2H3,(H,18,19)/t13-/m0/s1.
What are the key properties of 3-[[(2S)-1,4-dioxan-2-yl]methyl-methylcarbamoyl]-5-methoxybenzoic acid?
3-[[(2S)-1,4-dioxan-2-yl]methyl-methylcarbamoyl]-5-methoxybenzoic acid has a molecular weight of 309.32 g/mol, XLogP of 0.88, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(2S)-1,4-dioxan-2-yl]methyl-methylcarbamoyl]-5-methoxybenzoic acid is sourced from PubChem (CID 125439013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).