C7H13NO4 — CID 68851137
1,4-dioxan-2-ylmethyl(methyl)carbamic acid (PubChem CID 68851137) has the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. Its IUPAC name is 1,4-dioxan-2-ylmethyl(methyl)carbamic acid.
| Compound Name | 1,4-dioxan-2-ylmethyl(methyl)carbamic acid |
|---|---|
| PubChem CID | 68851137 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 1,4-dioxan-2-ylmethyl(methyl)carbamic acid |
| SMILES | CN(CC1COCCO1)C(=O)O |
| InChI | InChI=1S/C7H13NO4/c1-8(7(9)10)4-6-5-11-2-3-12-6/h6H,2-5H2,1H3,(H,9,10) |
| InChIKey | KCUYSRRGEWTNKB-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |