1,4-dioxan-2-ylmethyl(methyl)carbamic acid

C7H13NO4 — CID 68851137

IUPAC1,4-dioxan-2-ylmethyl(methyl)carbamic acid
SMILESCN(CC1COCCO1)C(=O)O
InChIInChI=1S/C7H13NO4/c1-8(7(9)10)4-6-5-11-2-3-12-6/h6H,2-5H2,1H3,(H,9,10)
InChIKeyKCUYSRRGEWTNKB-UHFFFAOYSA-N
MW175.18 g/mol
LogP0.01
Rot. Bonds2

About 1,4-dioxan-2-ylmethyl(methyl)carbamic acid

1,4-dioxan-2-ylmethyl(methyl)carbamic acid (PubChem CID 68851137) has the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. Its IUPAC name is 1,4-dioxan-2-ylmethyl(methyl)carbamic acid.

Molecular Properties

Compound Name1,4-dioxan-2-ylmethyl(methyl)carbamic acid
PubChem CID68851137
Molecular FormulaC7H13NO4
Molecular Weight175.18 g/mol
Exact Mass175.08
IUPAC Name1,4-dioxan-2-ylmethyl(methyl)carbamic acid
SMILESCN(CC1COCCO1)C(=O)O
InChIInChI=1S/C7H13NO4/c1-8(7(9)10)4-6-5-11-2-3-12-6/h6H,2-5H2,1H3,(H,9,10)
InChIKeyKCUYSRRGEWTNKB-UHFFFAOYSA-N
XLogP0.01
TPSA59.00 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500175.18
LogP ≤ 50.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1,4-dioxan-2-ylmethyl(methyl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,4-dioxan-2-ylmethyl(methyl)carbamic acid?
The IUPAC name of 1,4-dioxan-2-ylmethyl(methyl)carbamic acid (CID 68851137) is 1,4-dioxan-2-ylmethyl(methyl)carbamic acid.
What is the SMILES notation for 1,4-dioxan-2-ylmethyl(methyl)carbamic acid?
The canonical SMILES for 1,4-dioxan-2-ylmethyl(methyl)carbamic acid is CN(CC1COCCO1)C(=O)O.
What is the InChIKey of 1,4-dioxan-2-ylmethyl(methyl)carbamic acid?
The InChIKey is KCUYSRRGEWTNKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO4/c1-8(7(9)10)4-6-5-11-2-3-12-6/h6H,2-5H2,1H3,(H,9,10).
What are the key properties of 1,4-dioxan-2-ylmethyl(methyl)carbamic acid?
1,4-dioxan-2-ylmethyl(methyl)carbamic acid has a molecular weight of 175.18 g/mol, XLogP of 0.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxan-2-ylmethyl(methyl)carbamic acid is sourced from PubChem (CID 68851137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).