C11H22N2O6S — CID 66972068
tert-butyl-[1,4-dioxan-2-ylmethyl(methyl)sulfamoyl]carbamic acid (PubChem CID 66972068) has the molecular formula C11H22N2O6S and a molecular weight of 310.37 g/mol. Its IUPAC name is tert-butyl-[1,4-dioxan-2-ylmethyl(methyl)sulfamoyl]carbamic acid.
| Compound Name | tert-butyl-[1,4-dioxan-2-ylmethyl(methyl)sulfamoyl]carbamic acid |
|---|---|
| PubChem CID | 66972068 |
| Molecular Formula | C11H22N2O6S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | tert-butyl-[1,4-dioxan-2-ylmethyl(methyl)sulfamoyl]carbamic acid |
| SMILES | CN(CC1COCCO1)S(=O)(=O)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C11H22N2O6S/c1-11(2,3)13(10(14)15)20(16,17)12(4)7-9-8-18-5-6-19-9/h9H,5-8H2,1-4H3,(H,14,15) |
| InChIKey | JKUYKSYTGGRYEP-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |