C11H22N2O3 — CID 167858059
(2S)-2-(1,4-dioxan-2-ylmethylamino)-3,3-dimethylbutanamide (PubChem CID 167858059) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is (2S)-2-(1,4-dioxan-2-ylmethylamino)-3,3-dimethylbutanamide.
| Compound Name | (2S)-2-(1,4-dioxan-2-ylmethylamino)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 167858059 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | (2S)-2-(1,4-dioxan-2-ylmethylamino)-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)[C@H](NCC1COCCO1)C(N)=O |
| InChI | InChI=1S/C11H22N2O3/c1-11(2,3)9(10(12)14)13-6-8-7-15-4-5-16-8/h8-9,13H,4-7H2,1-3H3,(H2,12,14)/t8?,9-/m1/s1 |
| InChIKey | UQZLQODSBDWMJB-YGPZHTELSA-N |
| XLogP | -0.11 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |