C11H22N2O3 — CID 61024472
2-(1,4-dioxan-2-ylmethylamino)-N-propylpropanamide (PubChem CID 61024472) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-(1,4-dioxan-2-ylmethylamino)-N-propylpropanamide.
| Compound Name | 2-(1,4-dioxan-2-ylmethylamino)-N-propylpropanamide |
|---|---|
| PubChem CID | 61024472 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 2-(1,4-dioxan-2-ylmethylamino)-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)NCC1COCCO1 |
| InChI | InChI=1S/C11H22N2O3/c1-3-4-12-11(14)9(2)13-7-10-8-15-5-6-16-10/h9-10,13H,3-8H2,1-2H3,(H,12,14) |
| InChIKey | ORUKPZHCWHCLBX-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |