C8H17N3O3 — CID 103242220
2-amino-3-(1,4-dioxan-2-ylmethylamino)propanamide (PubChem CID 103242220) has the molecular formula C8H17N3O3 and a molecular weight of 203.24 g/mol. Its IUPAC name is 2-amino-3-(1,4-dioxan-2-ylmethylamino)propanamide.
| Compound Name | 2-amino-3-(1,4-dioxan-2-ylmethylamino)propanamide |
|---|---|
| PubChem CID | 103242220 |
| Molecular Formula | C8H17N3O3 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 2-amino-3-(1,4-dioxan-2-ylmethylamino)propanamide |
| SMILES | NC(=O)C(N)CNCC1COCCO1 |
| InChI | InChI=1S/C8H17N3O3/c9-7(8(10)12)4-11-3-6-5-13-1-2-14-6/h6-7,11H,1-5,9H2,(H2,10,12) |
| InChIKey | SQJAAIHSTOOATQ-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |