C10H20N2O5S — CID 54907981
2-amino-N-(1,4-dioxan-2-ylmethyl)-4-methylsulfonylbutanamide (PubChem CID 54907981) has the molecular formula C10H20N2O5S and a molecular weight of 280.35 g/mol. Its IUPAC name is 2-amino-N-(1,4-dioxan-2-ylmethyl)-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-(1,4-dioxan-2-ylmethyl)-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 54907981 |
| Molecular Formula | C10H20N2O5S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-amino-N-(1,4-dioxan-2-ylmethyl)-4-methylsulfonylbutanamide |
| SMILES | CS(=O)(=O)CCC(N)C(=O)NCC1COCCO1 |
| InChI | InChI=1S/C10H20N2O5S/c1-18(14,15)5-2-9(11)10(13)12-6-8-7-16-3-4-17-8/h8-9H,2-7,11H2,1H3,(H,12,13) |
| InChIKey | RONVXJTZSHAULS-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |