C12H23N3O5S — CID 83097232
4-(2-amino-4-methylsulfonylbutanoyl)-N-ethylmorpholine-3-carboxamide (PubChem CID 83097232) has the molecular formula C12H23N3O5S and a molecular weight of 321.40 g/mol. Its IUPAC name is 4-(2-amino-4-methylsulfonylbutanoyl)-N-ethylmorpholine-3-carboxamide.
| Compound Name | 4-(2-amino-4-methylsulfonylbutanoyl)-N-ethylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 83097232 |
| Molecular Formula | C12H23N3O5S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 4-(2-amino-4-methylsulfonylbutanoyl)-N-ethylmorpholine-3-carboxamide |
| SMILES | CCNC(=O)C1COCCN1C(=O)C(N)CCS(C)(=O)=O |
| InChI | InChI=1S/C12H23N3O5S/c1-3-14-11(16)10-8-20-6-5-15(10)12(17)9(13)4-7-21(2,18)19/h9-10H,3-8,13H2,1-2H3,(H,14,16) |
| InChIKey | PAWQVBSCTJEDPO-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |