C9H16N2O4 — CID 116657408
methyl 3-(ethylcarbamoyl)morpholine-4-carboxylate (PubChem CID 116657408) has the molecular formula C9H16N2O4 and a molecular weight of 216.24 g/mol. Its IUPAC name is methyl 3-(ethylcarbamoyl)morpholine-4-carboxylate.
| Compound Name | methyl 3-(ethylcarbamoyl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 116657408 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | methyl 3-(ethylcarbamoyl)morpholine-4-carboxylate |
| SMILES | CCNC(=O)C1COCCN1C(=O)OC |
| InChI | InChI=1S/C9H16N2O4/c1-3-10-8(12)7-6-15-5-4-11(7)9(13)14-2/h7H,3-6H2,1-2H3,(H,10,12) |
| InChIKey | AWFJTUWLODZZFR-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |