C11H21N3O3 — CID 116657396
3-N-ethyl-4-N-propan-2-ylmorpholine-3,4-dicarboxamide (PubChem CID 116657396) has the molecular formula C11H21N3O3 and a molecular weight of 243.31 g/mol. Its IUPAC name is 3-N-ethyl-4-N-propan-2-ylmorpholine-3,4-dicarboxamide.
| Compound Name | 3-N-ethyl-4-N-propan-2-ylmorpholine-3,4-dicarboxamide |
|---|---|
| PubChem CID | 116657396 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 3-N-ethyl-4-N-propan-2-ylmorpholine-3,4-dicarboxamide |
| SMILES | CCNC(=O)C1COCCN1C(=O)NC(C)C |
| InChI | InChI=1S/C11H21N3O3/c1-4-12-10(15)9-7-17-6-5-14(9)11(16)13-8(2)3/h8-9H,4-7H2,1-3H3,(H,12,15)(H,13,16) |
| InChIKey | QRVWFTWHNNFXSF-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |