C8H15N3O3 — CID 83106248
3-N-ethylmorpholine-3,4-dicarboxamide (PubChem CID 83106248) has the molecular formula C8H15N3O3 and a molecular weight of 201.23 g/mol. Its IUPAC name is 3-N-ethylmorpholine-3,4-dicarboxamide.
| Compound Name | 3-N-ethylmorpholine-3,4-dicarboxamide |
|---|---|
| PubChem CID | 83106248 |
| Molecular Formula | C8H15N3O3 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | 3-N-ethylmorpholine-3,4-dicarboxamide |
| SMILES | CCNC(=O)C1COCCN1C(N)=O |
| InChI | InChI=1S/C8H15N3O3/c1-2-10-7(12)6-5-14-4-3-11(6)8(9)13/h6H,2-5H2,1H3,(H2,9,13)(H,10,12) |
| InChIKey | FDMOHRPAKJXOKO-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |