C10H20N2O4S — CID 106774307
2-amino-1-[(3R)-3-methylmorpholin-4-yl]-4-methylsulfonylbutan-1-one (PubChem CID 106774307) has the molecular formula C10H20N2O4S and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-amino-1-[(3R)-3-methylmorpholin-4-yl]-4-methylsulfonylbutan-1-one.
| Compound Name | 2-amino-1-[(3R)-3-methylmorpholin-4-yl]-4-methylsulfonylbutan-1-one |
|---|---|
| PubChem CID | 106774307 |
| Molecular Formula | C10H20N2O4S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-amino-1-[(3R)-3-methylmorpholin-4-yl]-4-methylsulfonylbutan-1-one |
| SMILES | C[C@@H]1COCCN1C(=O)C(N)CCS(C)(=O)=O |
| InChI | InChI=1S/C10H20N2O4S/c1-8-7-16-5-4-12(8)10(13)9(11)3-6-17(2,14)15/h8-9H,3-7,11H2,1-2H3/t8-,9?/m1/s1 |
| InChIKey | HRGFFIILXCYDKK-VEDVMXKPSA-N |
| XLogP | -1.00 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |