C11H22N2O4S — CID 65106258
2-amino-N-[(1-hydroxycyclopentyl)methyl]-4-methylsulfonylbutanamide (PubChem CID 65106258) has the molecular formula C11H22N2O4S and a molecular weight of 278.37 g/mol. Its IUPAC name is 2-amino-N-[(1-hydroxycyclopentyl)methyl]-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-[(1-hydroxycyclopentyl)methyl]-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 65106258 |
| Molecular Formula | C11H22N2O4S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-amino-N-[(1-hydroxycyclopentyl)methyl]-4-methylsulfonylbutanamide |
| SMILES | CS(=O)(=O)CCC(N)C(=O)NCC1(O)CCCC1 |
| InChI | InChI=1S/C11H22N2O4S/c1-18(16,17)7-4-9(12)10(14)13-8-11(15)5-2-3-6-11/h9,15H,2-8,12H2,1H3,(H,13,14) |
| InChIKey | IFYKEPYUBAPIBN-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |