C9H17NO4 — CID 61025111
ethyl 2-(1,4-dioxan-2-ylmethylamino)acetate (PubChem CID 61025111) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is ethyl 2-(1,4-dioxan-2-ylmethylamino)acetate.
| Compound Name | ethyl 2-(1,4-dioxan-2-ylmethylamino)acetate |
|---|---|
| PubChem CID | 61025111 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | ethyl 2-(1,4-dioxan-2-ylmethylamino)acetate |
| SMILES | CCOC(=O)CNCC1COCCO1 |
| InChI | InChI=1S/C9H17NO4/c1-2-13-9(11)6-10-5-8-7-12-3-4-14-8/h8,10H,2-7H2,1H3 |
| InChIKey | QRIQUTXAOQIOOX-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |