C8H15N3O4 — CID 60976759
N-carbamoyl-2-(1,4-dioxan-2-ylmethylamino)acetamide (PubChem CID 60976759) has the molecular formula C8H15N3O4 and a molecular weight of 217.22 g/mol. Its IUPAC name is N-carbamoyl-2-(1,4-dioxan-2-ylmethylamino)acetamide.
| Compound Name | N-carbamoyl-2-(1,4-dioxan-2-ylmethylamino)acetamide |
|---|---|
| PubChem CID | 60976759 |
| Molecular Formula | C8H15N3O4 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | N-carbamoyl-2-(1,4-dioxan-2-ylmethylamino)acetamide |
| SMILES | NC(=O)NC(=O)CNCC1COCCO1 |
| InChI | InChI=1S/C8H15N3O4/c9-8(13)11-7(12)4-10-3-6-5-14-1-2-15-6/h6,10H,1-5H2,(H3,9,11,12,13) |
| InChIKey | OBECRRLTQYCKJE-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |