C18H35NO7 — CID 155141144
N-tert-butyl-2-(1,4,7,10,13,16-hexaoxacyclooctadec-2-yl)acetamide (PubChem CID 155141144) has the molecular formula C18H35NO7 and a molecular weight of 377.48 g/mol. Its IUPAC name is N-tert-butyl-2-(1,4,7,10,13,16-hexaoxacyclooctadec-2-yl)acetamide.
| Compound Name | N-tert-butyl-2-(1,4,7,10,13,16-hexaoxacyclooctadec-2-yl)acetamide |
|---|---|
| PubChem CID | 155141144 |
| Molecular Formula | C18H35NO7 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | N-tert-butyl-2-(1,4,7,10,13,16-hexaoxacyclooctadec-2-yl)acetamide |
| SMILES | CC(C)(C)NC(=O)CC1COCCOCCOCCOCCOCCO1 |
| InChI | InChI=1S/C18H35NO7/c1-18(2,3)19-17(20)14-16-15-25-11-10-23-7-6-21-4-5-22-8-9-24-12-13-26-16/h16H,4-15H2,1-3H3,(H,19,20) |
| InChIKey | VWMBJEDDORSNEV-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |