C16H32ClNO7S — CID 140581492
N-chloro-2-methyl-3-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethylsulfonyl)butan-2-amine (PubChem CID 140581492) has the molecular formula C16H32ClNO7S and a molecular weight of 417.95 g/mol. Its IUPAC name is N-chloro-2-methyl-3-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethylsulfonyl)butan-2-amine.
| Compound Name | N-chloro-2-methyl-3-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethylsulfonyl)butan-2-amine |
|---|---|
| PubChem CID | 140581492 |
| Molecular Formula | C16H32ClNO7S |
| Molecular Weight | 417.95 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | N-chloro-2-methyl-3-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethylsulfonyl)butan-2-amine |
| SMILES | CC(C(C)(C)NCl)S(=O)(=O)CC1COCCOCCOCCOCCO1 |
| InChI | InChI=1S/C16H32ClNO7S/c1-14(16(2,3)18-17)26(19,20)13-15-12-24-9-8-22-5-4-21-6-7-23-10-11-25-15/h14-15,18H,4-13H2,1-3H3 |
| InChIKey | PQKFEOMVSBUNJR-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.95 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|