C14H28ClNO6S — CID 140581503
N-chloro-2-methyl-3-(1,4,7,10-tetraoxacyclododec-2-ylmethylsulfonyl)butan-2-amine (PubChem CID 140581503) has the molecular formula C14H28ClNO6S and a molecular weight of 373.90 g/mol. Its IUPAC name is N-chloro-2-methyl-3-(1,4,7,10-tetraoxacyclododec-2-ylmethylsulfonyl)butan-2-amine.
| Compound Name | N-chloro-2-methyl-3-(1,4,7,10-tetraoxacyclododec-2-ylmethylsulfonyl)butan-2-amine |
|---|---|
| PubChem CID | 140581503 |
| Molecular Formula | C14H28ClNO6S |
| Molecular Weight | 373.90 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | N-chloro-2-methyl-3-(1,4,7,10-tetraoxacyclododec-2-ylmethylsulfonyl)butan-2-amine |
| SMILES | CC(C(C)(C)NCl)S(=O)(=O)CC1COCCOCCOCCO1 |
| InChI | InChI=1S/C14H28ClNO6S/c1-12(14(2,3)16-15)23(17,18)11-13-10-21-7-6-19-4-5-20-8-9-22-13/h12-13,16H,4-11H2,1-3H3 |
| InChIKey | QMSAGIYTJUSQNG-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.90 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|