About N-[[(2R)-1,4-dioxan-2-yl]methyl]-N,2-dimethylbutan-2-amine
N-[[(2R)-1,4-dioxan-2-yl]methyl]-N,2-dimethylbutan-2-amine (PubChem CID 126515563) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is N-[[(2R)-1,4-dioxan-2-yl]methyl]-N,2-dimethylbutan-2-amine.
Molecular Properties
| Compound Name | N-[[(2R)-1,4-dioxan-2-yl]methyl]-N,2-dimethylbutan-2-amine |
| PubChem CID | 126515563 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | N-[[(2R)-1,4-dioxan-2-yl]methyl]-N,2-dimethylbutan-2-amine |
| SMILES | CCC(C)(C)N(C)C[C@@H]1COCCO1 |
| InChI | InChI=1S/C11H23NO2/c1-5-11(2,3)12(4)8-10-9-13-6-7-14-10/h10H,5-9H2,1-4H3/t10-/m1/s1 |
| InChIKey | SNZPBDZQDJKPRJ-SNVBAGLBSA-N |
| XLogP | 1.52 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[(2R)-1,4-dioxan-2-yl]methyl]-N,2-dimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(2R)-1,4-dioxan-2-yl]methyl]-N,2-dimethylbutan-2-amine?
The IUPAC name of N-[[(2R)-1,4-dioxan-2-yl]methyl]-N,2-dimethylbutan-2-amine (CID 126515563) is N-[[(2R)-1,4-dioxan-2-yl]methyl]-N,2-dimethylbutan-2-amine.
What is the SMILES notation for N-[[(2R)-1,4-dioxan-2-yl]methyl]-N,2-dimethylbutan-2-amine?
The canonical SMILES for N-[[(2R)-1,4-dioxan-2-yl]methyl]-N,2-dimethylbutan-2-amine is CCC(C)(C)N(C)C[C@@H]1COCCO1.
What is the InChIKey of N-[[(2R)-1,4-dioxan-2-yl]methyl]-N,2-dimethylbutan-2-amine?
The InChIKey is SNZPBDZQDJKPRJ-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H23NO2/c1-5-11(2,3)12(4)8-10-9-13-6-7-14-10/h10H,5-9H2,1-4H3/t10-/m1/s1.
What are the key properties of N-[[(2R)-1,4-dioxan-2-yl]methyl]-N,2-dimethylbutan-2-amine?
N-[[(2R)-1,4-dioxan-2-yl]methyl]-N,2-dimethylbutan-2-amine has a molecular weight of 201.31 g/mol, XLogP of 1.52, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(2R)-1,4-dioxan-2-yl]methyl]-N,2-dimethylbutan-2-amine is sourced from PubChem (CID 126515563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).