About N-(1,4-dioxan-2-ylmethyl)-N-methyl-3,3-diphenylpropanamide
N-(1,4-dioxan-2-ylmethyl)-N-methyl-3,3-diphenylpropanamide (PubChem CID 86286846) has the molecular formula C21H25NO3
and a molecular weight of 339.44 g/mol. Its IUPAC name is N-(1,4-dioxan-2-ylmethyl)-N-methyl-3,3-diphenylpropanamide.
Molecular Properties
| Compound Name | N-(1,4-dioxan-2-ylmethyl)-N-methyl-3,3-diphenylpropanamide |
| PubChem CID | 86286846 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | N-(1,4-dioxan-2-ylmethyl)-N-methyl-3,3-diphenylpropanamide |
| SMILES | CN(CC1COCCO1)C(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO3/c1-22(15-19-16-24-12-13-25-19)21(23)14-20(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-11,19-20H,12-16H2,1H3 |
| InChIKey | MUQLFDKGXXKWAS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1,4-dioxan-2-ylmethyl)-N-methyl-3,3-diphenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,4-dioxan-2-ylmethyl)-N-methyl-3,3-diphenylpropanamide?
The IUPAC name of N-(1,4-dioxan-2-ylmethyl)-N-methyl-3,3-diphenylpropanamide (CID 86286846) is N-(1,4-dioxan-2-ylmethyl)-N-methyl-3,3-diphenylpropanamide.
What is the SMILES notation for N-(1,4-dioxan-2-ylmethyl)-N-methyl-3,3-diphenylpropanamide?
The canonical SMILES for N-(1,4-dioxan-2-ylmethyl)-N-methyl-3,3-diphenylpropanamide is CN(CC1COCCO1)C(=O)CC(c1ccccc1)c1ccccc1.
What is the InChIKey of N-(1,4-dioxan-2-ylmethyl)-N-methyl-3,3-diphenylpropanamide?
The InChIKey is MUQLFDKGXXKWAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO3/c1-22(15-19-16-24-12-13-25-19)21(23)14-20(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-11,19-20H,12-16H2,1H3.
What are the key properties of N-(1,4-dioxan-2-ylmethyl)-N-methyl-3,3-diphenylpropanamide?
N-(1,4-dioxan-2-ylmethyl)-N-methyl-3,3-diphenylpropanamide has a molecular weight of 339.44 g/mol, XLogP of 3.08, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,4-dioxan-2-ylmethyl)-N-methyl-3,3-diphenylpropanamide is sourced from PubChem (CID 86286846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).